C15H24N2O — CID 114460062
2-(4-tert-butyl-3,6-dihydro-2H-pyridine-1-carbonyl)-2-methylbutanenitrile (PubChem CID 114460062) has the molecular formula C15H24N2O and a molecular weight of 248.37 g/mol. Its IUPAC name is 2-(4-tert-butyl-3,6-dihydro-2H-pyridine-1-carbonyl)-2-methylbutanenitrile.
| Compound Name | 2-(4-tert-butyl-3,6-dihydro-2H-pyridine-1-carbonyl)-2-methylbutanenitrile |
|---|---|
| PubChem CID | 114460062 |
| Molecular Formula | C15H24N2O |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.19 |
| IUPAC Name | 2-(4-tert-butyl-3,6-dihydro-2H-pyridine-1-carbonyl)-2-methylbutanenitrile |
| SMILES | CCC(C)(C#N)C(=O)N1CC=C(C(C)(C)C)CC1 |
| InChI | InChI=1S/C15H24N2O/c1-6-15(5,11-16)13(18)17-9-7-12(8-10-17)14(2,3)4/h7H,6,8-10H2,1-5H3 |
| InChIKey | RDSLCUJDWGTJBO-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 44.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|