C15H30N2 — CID 114460425
2-[(4-tert-butyl-3,6-dihydro-2H-pyridin-1-yl)methyl]-2-methylbutan-1-amine (PubChem CID 114460425) has the molecular formula C15H30N2 and a molecular weight of 238.42 g/mol. Its IUPAC name is 2-[(4-tert-butyl-3,6-dihydro-2H-pyridin-1-yl)methyl]-2-methylbutan-1-amine.
| Compound Name | 2-[(4-tert-butyl-3,6-dihydro-2H-pyridin-1-yl)methyl]-2-methylbutan-1-amine |
|---|---|
| PubChem CID | 114460425 |
| Molecular Formula | C15H30N2 |
| Molecular Weight | 238.42 g/mol |
| Exact Mass | 238.24 |
| IUPAC Name | 2-[(4-tert-butyl-3,6-dihydro-2H-pyridin-1-yl)methyl]-2-methylbutan-1-amine |
| SMILES | CCC(C)(CN)CN1CC=C(C(C)(C)C)CC1 |
| InChI | InChI=1S/C15H30N2/c1-6-15(5,11-16)12-17-9-7-13(8-10-17)14(2,3)4/h7H,6,8-12,16H2,1-5H3 |
| InChIKey | CRBYUMRQCFYTKE-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.42 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|