C15H24N2O3S — CID 114460633
3-(4-tert-butyl-3,6-dihydro-2H-pyridine-1-carbonyl)-2-methyl-1,3-thiazolidine-4-carboxylic acid (PubChem CID 114460633) has the molecular formula C15H24N2O3S and a molecular weight of 312.44 g/mol. Its IUPAC name is 3-(4-tert-butyl-3,6-dihydro-2H-pyridine-1-carbonyl)-2-methyl-1,3-thiazolidine-4-carboxylic acid.
| Compound Name | 3-(4-tert-butyl-3,6-dihydro-2H-pyridine-1-carbonyl)-2-methyl-1,3-thiazolidine-4-carboxylic acid |
|---|---|
| PubChem CID | 114460633 |
| Molecular Formula | C15H24N2O3S |
| Molecular Weight | 312.44 g/mol |
| Exact Mass | 312.15 |
| IUPAC Name | 3-(4-tert-butyl-3,6-dihydro-2H-pyridine-1-carbonyl)-2-methyl-1,3-thiazolidine-4-carboxylic acid |
| SMILES | CC1SCC(C(=O)O)N1C(=O)N1CC=C(C(C)(C)C)CC1 |
| InChI | InChI=1S/C15H24N2O3S/c1-10-17(12(9-21-10)13(18)19)14(20)16-7-5-11(6-8-16)15(2,3)4/h5,10,12H,6-9H2,1-4H3,(H,18,19) |
| InChIKey | UHTRASYMJMVRJK-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.44 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|