C14H22N4O — CID 114460667
(4-tert-butyl-3,6-dihydro-2H-pyridin-1-yl)-(5-ethyl-1H-1,2,4-triazol-3-yl)methanone (PubChem CID 114460667) has the molecular formula C14H22N4O and a molecular weight of 262.36 g/mol. Its IUPAC name is (4-tert-butyl-3,6-dihydro-2H-pyridin-1-yl)-(5-ethyl-1H-1,2,4-triazol-3-yl)methanone.
| Compound Name | (4-tert-butyl-3,6-dihydro-2H-pyridin-1-yl)-(5-ethyl-1H-1,2,4-triazol-3-yl)methanone |
|---|---|
| PubChem CID | 114460667 |
| Molecular Formula | C14H22N4O |
| Molecular Weight | 262.36 g/mol |
| Exact Mass | 262.18 |
| IUPAC Name | (4-tert-butyl-3,6-dihydro-2H-pyridin-1-yl)-(5-ethyl-1H-1,2,4-triazol-3-yl)methanone |
| SMILES | CCc1nc(C(=O)N2CC=C(C(C)(C)C)CC2)n[nH]1 |
| InChI | InChI=1S/C14H22N4O/c1-5-11-15-12(17-16-11)13(19)18-8-6-10(7-9-18)14(2,3)4/h6H,5,7-9H2,1-4H3,(H,15,16,17) |
| InChIKey | OHIGGCAKWLVPEN-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.36 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|