C18H36N2 — CID 114460914
2-(4-tert-butyl-3,6-dihydro-2H-pyridin-1-yl)-3-methyl-N-(2-methylpropyl)butan-1-amine (PubChem CID 114460914) has the molecular formula C18H36N2 and a molecular weight of 280.50 g/mol. Its IUPAC name is 2-(4-tert-butyl-3,6-dihydro-2H-pyridin-1-yl)-3-methyl-N-(2-methylpropyl)butan-1-amine.
| Compound Name | 2-(4-tert-butyl-3,6-dihydro-2H-pyridin-1-yl)-3-methyl-N-(2-methylpropyl)butan-1-amine |
|---|---|
| PubChem CID | 114460914 |
| Molecular Formula | C18H36N2 |
| Molecular Weight | 280.50 g/mol |
| Exact Mass | 280.29 |
| IUPAC Name | 2-(4-tert-butyl-3,6-dihydro-2H-pyridin-1-yl)-3-methyl-N-(2-methylpropyl)butan-1-amine |
| SMILES | CC(C)CNCC(C(C)C)N1CC=C(C(C)(C)C)CC1 |
| InChI | InChI=1S/C18H36N2/c1-14(2)12-19-13-17(15(3)4)20-10-8-16(9-11-20)18(5,6)7/h8,14-15,17,19H,9-13H2,1-7H3 |
| InChIKey | NNRUMEXQSLVATH-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.50 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|