C13H27N3O4S — CID 114461302
propan-2-yl N-[[1-(aminomethyl)cyclohexyl]-ethylsulfamoyl]carbamate (PubChem CID 114461302) has the molecular formula C13H27N3O4S and a molecular weight of 321.44 g/mol. Its IUPAC name is propan-2-yl N-[[1-(aminomethyl)cyclohexyl]-ethylsulfamoyl]carbamate.
| Compound Name | propan-2-yl N-[[1-(aminomethyl)cyclohexyl]-ethylsulfamoyl]carbamate |
|---|---|
| PubChem CID | 114461302 |
| Molecular Formula | C13H27N3O4S |
| Molecular Weight | 321.44 g/mol |
| Exact Mass | 321.17 |
| IUPAC Name | propan-2-yl N-[[1-(aminomethyl)cyclohexyl]-ethylsulfamoyl]carbamate |
| SMILES | CCN(C1(CN)CCCCC1)S(=O)(=O)NC(=O)OC(C)C |
| InChI | InChI=1S/C13H27N3O4S/c1-4-16(13(10-14)8-6-5-7-9-13)21(18,19)15-12(17)20-11(2)3/h11H,4-10,14H2,1-3H3,(H,15,17) |
| InChIKey | XCJKQCBROFYMBG-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.44 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |