C12H25N3O4S — CID 114461303
ethyl N-[[1-(aminomethyl)cyclohexyl]-ethylsulfamoyl]carbamate (PubChem CID 114461303) has the molecular formula C12H25N3O4S and a molecular weight of 307.42 g/mol. Its IUPAC name is ethyl N-[[1-(aminomethyl)cyclohexyl]-ethylsulfamoyl]carbamate.
| Compound Name | ethyl N-[[1-(aminomethyl)cyclohexyl]-ethylsulfamoyl]carbamate |
|---|---|
| PubChem CID | 114461303 |
| Molecular Formula | C12H25N3O4S |
| Molecular Weight | 307.42 g/mol |
| Exact Mass | 307.16 |
| IUPAC Name | ethyl N-[[1-(aminomethyl)cyclohexyl]-ethylsulfamoyl]carbamate |
| SMILES | CCOC(=O)NS(=O)(=O)N(CC)C1(CN)CCCCC1 |
| InChI | InChI=1S/C12H25N3O4S/c1-3-15(12(10-13)8-6-5-7-9-12)20(17,18)14-11(16)19-4-2/h3-10,13H2,1-2H3,(H,14,16) |
| InChIKey | GULRPMJILILMMP-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.42 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |