C10H18N2O6S — CID 114462405
1-(methoxycarbonylsulfamoylamino)-2-methylcyclohexane-1-carboxylic acid (PubChem CID 114462405) has the molecular formula C10H18N2O6S and a molecular weight of 294.33 g/mol. Its IUPAC name is 1-(methoxycarbonylsulfamoylamino)-2-methylcyclohexane-1-carboxylic acid.
| Compound Name | 1-(methoxycarbonylsulfamoylamino)-2-methylcyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 114462405 |
| Molecular Formula | C10H18N2O6S |
| Molecular Weight | 294.33 g/mol |
| Exact Mass | 294.09 |
| IUPAC Name | 1-(methoxycarbonylsulfamoylamino)-2-methylcyclohexane-1-carboxylic acid |
| SMILES | COC(=O)NS(=O)(=O)NC1(C(=O)O)CCCCC1C |
| InChI | InChI=1S/C10H18N2O6S/c1-7-5-3-4-6-10(7,8(13)14)12-19(16,17)11-9(15)18-2/h7,12H,3-6H2,1-2H3,(H,11,15)(H,13,14) |
| InChIKey | YXDWOQWMHDGKQB-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 121.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.33 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |