C13H21N3O4S — CID 114463183
ethyl N-[[2-[1-(ethylamino)ethyl]phenyl]sulfamoyl]carbamate (PubChem CID 114463183) has the molecular formula C13H21N3O4S and a molecular weight of 315.40 g/mol. Its IUPAC name is ethyl N-[[2-[1-(ethylamino)ethyl]phenyl]sulfamoyl]carbamate.
| Compound Name | ethyl N-[[2-[1-(ethylamino)ethyl]phenyl]sulfamoyl]carbamate |
|---|---|
| PubChem CID | 114463183 |
| Molecular Formula | C13H21N3O4S |
| Molecular Weight | 315.40 g/mol |
| Exact Mass | 315.13 |
| IUPAC Name | ethyl N-[[2-[1-(ethylamino)ethyl]phenyl]sulfamoyl]carbamate |
| SMILES | CCNC(C)c1ccccc1NS(=O)(=O)NC(=O)OCC |
| InChI | InChI=1S/C13H21N3O4S/c1-4-14-10(3)11-8-6-7-9-12(11)15-21(18,19)16-13(17)20-5-2/h6-10,14-15H,4-5H2,1-3H3,(H,16,17) |
| InChIKey | JLZXSKHBINZTQJ-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.40 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |