About 2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazole
2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazole (PubChem CID 11446338) has the molecular formula C5H8N2S
and a molecular weight of 128.20 g/mol. Its IUPAC name is 2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazole.
Analyze 2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazole?
The IUPAC name of 2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazole (CID 11446338) is 2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazole.
What is the SMILES notation for 2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazole?
The canonical SMILES for 2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazole is C1CN2CCSC2=N1.
What is the InChIKey of 2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazole?
The InChIKey is NGKOCETVOBCCII-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8N2S/c1-2-7-3-4-8-5(7)6-1/h1-4H2.
What are the key properties of 2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazole?
2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazole has a molecular weight of 128.20 g/mol, XLogP of 0.40, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazole is sourced from PubChem (CID 11446338), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).