C10H14N2O5S — CID 114463964
methyl N-[2-(4-hydroxyphenyl)ethylsulfamoyl]carbamate (PubChem CID 114463964) has the molecular formula C10H14N2O5S and a molecular weight of 274.30 g/mol. Its IUPAC name is methyl N-[2-(4-hydroxyphenyl)ethylsulfamoyl]carbamate.
| Compound Name | methyl N-[2-(4-hydroxyphenyl)ethylsulfamoyl]carbamate |
|---|---|
| PubChem CID | 114463964 |
| Molecular Formula | C10H14N2O5S |
| Molecular Weight | 274.30 g/mol |
| Exact Mass | 274.06 |
| IUPAC Name | methyl N-[2-(4-hydroxyphenyl)ethylsulfamoyl]carbamate |
| SMILES | COC(=O)NS(=O)(=O)NCCc1ccc(O)cc1 |
| InChI | InChI=1S/C10H14N2O5S/c1-17-10(14)12-18(15,16)11-7-6-8-2-4-9(13)5-3-8/h2-5,11,13H,6-7H2,1H3,(H,12,14) |
| InChIKey | VUYQTSDGWGMFEN-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.30 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |