About (3-cyano-1,3-thiazolidin-2-ylidene)cyanamide
(3-cyano-1,3-thiazolidin-2-ylidene)cyanamide (PubChem CID 11446447) has the molecular formula C5H4N4S
and a molecular weight of 152.18 g/mol. Its IUPAC name is (3-cyano-1,3-thiazolidin-2-ylidene)cyanamide.
Molecular Properties
| Compound Name | (3-cyano-1,3-thiazolidin-2-ylidene)cyanamide |
| PubChem CID | 11446447 |
| Molecular Formula | C5H4N4S |
| Molecular Weight | 152.18 g/mol |
| Exact Mass | 152.02 |
| IUPAC Name | (3-cyano-1,3-thiazolidin-2-ylidene)cyanamide |
| SMILES | N#C/N=C1\SCCN1C#N |
| InChI | InChI=1S/C5H4N4S/c6-3-8-5-9(4-7)1-2-10-5/h1-2H2/b8-5- |
| InChIKey | JRBSIHLDYTYJFD-YVMONPNESA-N |
| XLogP | 0.35 |
| TPSA | 63.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.18 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (3-cyano-1,3-thiazolidin-2-ylidene)cyanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-cyano-1,3-thiazolidin-2-ylidene)cyanamide?
The IUPAC name of (3-cyano-1,3-thiazolidin-2-ylidene)cyanamide (CID 11446447) is (3-cyano-1,3-thiazolidin-2-ylidene)cyanamide.
What is the SMILES notation for (3-cyano-1,3-thiazolidin-2-ylidene)cyanamide?
The canonical SMILES for (3-cyano-1,3-thiazolidin-2-ylidene)cyanamide is N#C/N=C1\SCCN1C#N.
What is the InChIKey of (3-cyano-1,3-thiazolidin-2-ylidene)cyanamide?
The InChIKey is JRBSIHLDYTYJFD-YVMONPNESA-N. The full InChI is InChI=1S/C5H4N4S/c6-3-8-5-9(4-7)1-2-10-5/h1-2H2/b8-5-.
What are the key properties of (3-cyano-1,3-thiazolidin-2-ylidene)cyanamide?
(3-cyano-1,3-thiazolidin-2-ylidene)cyanamide has a molecular weight of 152.18 g/mol, XLogP of 0.35, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3-cyano-1,3-thiazolidin-2-ylidene)cyanamide is sourced from PubChem (CID 11446447), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).