About methyl N-(2,2-dimethyl-3,5-dioxopiperazin-1-yl)sulfonylcarbamate
methyl N-(2,2-dimethyl-3,5-dioxopiperazin-1-yl)sulfonylcarbamate (PubChem CID 114464543) has the molecular formula C8H13N3O6S
and a molecular weight of 279.27 g/mol. Its IUPAC name is methyl N-(2,2-dimethyl-3,5-dioxopiperazin-1-yl)sulfonylcarbamate.
Molecular Properties
| Compound Name | methyl N-(2,2-dimethyl-3,5-dioxopiperazin-1-yl)sulfonylcarbamate |
| PubChem CID | 114464543 |
| Molecular Formula | C8H13N3O6S |
| Molecular Weight | 279.27 g/mol |
| Exact Mass | 279.05 |
| IUPAC Name | methyl N-(2,2-dimethyl-3,5-dioxopiperazin-1-yl)sulfonylcarbamate |
| SMILES | COC(=O)NS(=O)(=O)N1CC(=O)NC(=O)C1(C)C |
| InChI | InChI=1S/C8H13N3O6S/c1-8(2)6(13)9-5(12)4-11(8)18(15,16)10-7(14)17-3/h4H2,1-3H3,(H,10,14)(H,9,12,13) |
| InChIKey | RVXFSEVUFNAEDI-UHFFFAOYSA-N |
| XLogP | -1.68 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.27 |
| LogP ≤ 5 | -1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze methyl N-(2,2-dimethyl-3,5-dioxopiperazin-1-yl)sulfonylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl N-(2,2-dimethyl-3,5-dioxopiperazin-1-yl)sulfonylcarbamate?
The IUPAC name of methyl N-(2,2-dimethyl-3,5-dioxopiperazin-1-yl)sulfonylcarbamate (CID 114464543) is methyl N-(2,2-dimethyl-3,5-dioxopiperazin-1-yl)sulfonylcarbamate.
What is the SMILES notation for methyl N-(2,2-dimethyl-3,5-dioxopiperazin-1-yl)sulfonylcarbamate?
The canonical SMILES for methyl N-(2,2-dimethyl-3,5-dioxopiperazin-1-yl)sulfonylcarbamate is COC(=O)NS(=O)(=O)N1CC(=O)NC(=O)C1(C)C.
What is the InChIKey of methyl N-(2,2-dimethyl-3,5-dioxopiperazin-1-yl)sulfonylcarbamate?
The InChIKey is RVXFSEVUFNAEDI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N3O6S/c1-8(2)6(13)9-5(12)4-11(8)18(15,16)10-7(14)17-3/h4H2,1-3H3,(H,10,14)(H,9,12,13).
What are the key properties of methyl N-(2,2-dimethyl-3,5-dioxopiperazin-1-yl)sulfonylcarbamate?
methyl N-(2,2-dimethyl-3,5-dioxopiperazin-1-yl)sulfonylcarbamate has a molecular weight of 279.27 g/mol, XLogP of -1.68, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl N-(2,2-dimethyl-3,5-dioxopiperazin-1-yl)sulfonylcarbamate is sourced from PubChem (CID 114464543), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).