C12H17ClN2O — CID 114465166
3-chloro-2-N-[2-(2-methylprop-2-enoxy)ethyl]benzene-1,2-diamine (PubChem CID 114465166) has the molecular formula C12H17ClN2O and a molecular weight of 240.73 g/mol. Its IUPAC name is 3-chloro-2-N-[2-(2-methylprop-2-enoxy)ethyl]benzene-1,2-diamine.
| Compound Name | 3-chloro-2-N-[2-(2-methylprop-2-enoxy)ethyl]benzene-1,2-diamine |
|---|---|
| PubChem CID | 114465166 |
| Molecular Formula | C12H17ClN2O |
| Molecular Weight | 240.73 g/mol |
| Exact Mass | 240.10 |
| IUPAC Name | 3-chloro-2-N-[2-(2-methylprop-2-enoxy)ethyl]benzene-1,2-diamine |
| SMILES | C=C(C)COCCNc1c(N)cccc1Cl |
| InChI | InChI=1S/C12H17ClN2O/c1-9(2)8-16-7-6-15-12-10(13)4-3-5-11(12)14/h3-5,15H,1,6-8,14H2,2H3 |
| InChIKey | UMFIBOPQCFHWLE-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.73 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|