C12H13FN2O5S — CID 114465625
ethyl N-[[4-fluoro-2-(3-hydroxyprop-1-ynyl)phenyl]sulfamoyl]carbamate (PubChem CID 114465625) has the molecular formula C12H13FN2O5S and a molecular weight of 316.31 g/mol. Its IUPAC name is ethyl N-[[4-fluoro-2-(3-hydroxyprop-1-ynyl)phenyl]sulfamoyl]carbamate.
| Compound Name | ethyl N-[[4-fluoro-2-(3-hydroxyprop-1-ynyl)phenyl]sulfamoyl]carbamate |
|---|---|
| PubChem CID | 114465625 |
| Molecular Formula | C12H13FN2O5S |
| Molecular Weight | 316.31 g/mol |
| Exact Mass | 316.05 |
| IUPAC Name | ethyl N-[[4-fluoro-2-(3-hydroxyprop-1-ynyl)phenyl]sulfamoyl]carbamate |
| SMILES | CCOC(=O)NS(=O)(=O)Nc1ccc(F)cc1C#CCO |
| InChI | InChI=1S/C12H13FN2O5S/c1-2-20-12(17)15-21(18,19)14-11-6-5-10(13)8-9(11)4-3-7-16/h5-6,8,14,16H,2,7H2,1H3,(H,15,17) |
| InChIKey | IDRBFHRSZZSGNC-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.31 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|