About [1]benzofuro[2,3-b]pyridine
[1]benzofuro[2,3-b]pyridine (PubChem CID 11446565) has the molecular formula C11H7NO
and a molecular weight of 169.18 g/mol. Its IUPAC name is [1]benzofuro[2,3-b]pyridine.
Molecular Properties
| Compound Name | [1]benzofuro[2,3-b]pyridine |
| PubChem CID | 11446565 |
| Molecular Formula | C11H7NO |
| Molecular Weight | 169.18 g/mol |
| Exact Mass | 169.05 |
| IUPAC Name | [1]benzofuro[2,3-b]pyridine |
| SMILES | c1ccc2c(c1)oc1ncccc12 |
| InChI | InChI=1S/C11H7NO/c1-2-6-10-8(4-1)9-5-3-7-12-11(9)13-10/h1-7H |
| InChIKey | BLUQJCZJRDOPGV-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.18 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [1]benzofuro[2,3-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1]benzofuro[2,3-b]pyridine?
The IUPAC name of [1]benzofuro[2,3-b]pyridine (CID 11446565) is [1]benzofuro[2,3-b]pyridine.
What is the SMILES notation for [1]benzofuro[2,3-b]pyridine?
The canonical SMILES for [1]benzofuro[2,3-b]pyridine is c1ccc2c(c1)oc1ncccc12.
What is the InChIKey of [1]benzofuro[2,3-b]pyridine?
The InChIKey is BLUQJCZJRDOPGV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H7NO/c1-2-6-10-8(4-1)9-5-3-7-12-11(9)13-10/h1-7H.
What are the key properties of [1]benzofuro[2,3-b]pyridine?
[1]benzofuro[2,3-b]pyridine has a molecular weight of 169.18 g/mol, XLogP of 2.98, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [1]benzofuro[2,3-b]pyridine is sourced from PubChem (CID 11446565), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).