C13H25NO2 — CID 114465655
2,2-dimethyl-N-[2-(2-methylprop-2-enoxy)ethyl]oxan-4-amine (PubChem CID 114465655) has the molecular formula C13H25NO2 and a molecular weight of 227.35 g/mol. Its IUPAC name is 2,2-dimethyl-N-[2-(2-methylprop-2-enoxy)ethyl]oxan-4-amine.
| Compound Name | 2,2-dimethyl-N-[2-(2-methylprop-2-enoxy)ethyl]oxan-4-amine |
|---|---|
| PubChem CID | 114465655 |
| Molecular Formula | C13H25NO2 |
| Molecular Weight | 227.35 g/mol |
| Exact Mass | 227.19 |
| IUPAC Name | 2,2-dimethyl-N-[2-(2-methylprop-2-enoxy)ethyl]oxan-4-amine |
| SMILES | C=C(C)COCCNC1CCOC(C)(C)C1 |
| InChI | InChI=1S/C13H25NO2/c1-11(2)10-15-8-6-14-12-5-7-16-13(3,4)9-12/h12,14H,1,5-10H2,2-4H3 |
| InChIKey | NNLSHFIVJFBPFT-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.35 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|