About 4-(aminomethyl)-1,2-dimethyl-N-[2-(2-methylprop-2-enoxy)ethyl]piperidin-4-amine
4-(aminomethyl)-1,2-dimethyl-N-[2-(2-methylprop-2-enoxy)ethyl]piperidin-4-amine (PubChem CID 114466178) has the molecular formula C14H29N3O
and a molecular weight of 255.41 g/mol. Its IUPAC name is 4-(aminomethyl)-1,2-dimethyl-N-[2-(2-methylprop-2-enoxy)ethyl]piperidin-4-amine.
Molecular Properties
| Compound Name | 4-(aminomethyl)-1,2-dimethyl-N-[2-(2-methylprop-2-enoxy)ethyl]piperidin-4-amine |
| PubChem CID | 114466178 |
| Molecular Formula | C14H29N3O |
| Molecular Weight | 255.41 g/mol |
| Exact Mass | 255.23 |
| IUPAC Name | 4-(aminomethyl)-1,2-dimethyl-N-[2-(2-methylprop-2-enoxy)ethyl]piperidin-4-amine |
| SMILES | C=C(C)COCCNC1(CN)CCN(C)C(C)C1 |
| InChI | InChI=1S/C14H29N3O/c1-12(2)10-18-8-6-16-14(11-15)5-7-17(4)13(3)9-14/h13,16H,1,5-11,15H2,2-4H3 |
| InChIKey | KRYBEUSAEMEGKH-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 50.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.41 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-(aminomethyl)-1,2-dimethyl-N-[2-(2-methylprop-2-enoxy)ethyl]piperidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(aminomethyl)-1,2-dimethyl-N-[2-(2-methylprop-2-enoxy)ethyl]piperidin-4-amine?
The IUPAC name of 4-(aminomethyl)-1,2-dimethyl-N-[2-(2-methylprop-2-enoxy)ethyl]piperidin-4-amine (CID 114466178) is 4-(aminomethyl)-1,2-dimethyl-N-[2-(2-methylprop-2-enoxy)ethyl]piperidin-4-amine.
What is the SMILES notation for 4-(aminomethyl)-1,2-dimethyl-N-[2-(2-methylprop-2-enoxy)ethyl]piperidin-4-amine?
The canonical SMILES for 4-(aminomethyl)-1,2-dimethyl-N-[2-(2-methylprop-2-enoxy)ethyl]piperidin-4-amine is C=C(C)COCCNC1(CN)CCN(C)C(C)C1.
What is the InChIKey of 4-(aminomethyl)-1,2-dimethyl-N-[2-(2-methylprop-2-enoxy)ethyl]piperidin-4-amine?
The InChIKey is KRYBEUSAEMEGKH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H29N3O/c1-12(2)10-18-8-6-16-14(11-15)5-7-17(4)13(3)9-14/h13,16H,1,5-11,15H2,2-4H3.
What are the key properties of 4-(aminomethyl)-1,2-dimethyl-N-[2-(2-methylprop-2-enoxy)ethyl]piperidin-4-amine?
4-(aminomethyl)-1,2-dimethyl-N-[2-(2-methylprop-2-enoxy)ethyl]piperidin-4-amine has a molecular weight of 255.41 g/mol, XLogP of 0.98, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(aminomethyl)-1,2-dimethyl-N-[2-(2-methylprop-2-enoxy)ethyl]piperidin-4-amine is sourced from PubChem (CID 114466178), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).