C8H18N2O — CID 114466320
N'-[2-(2-methylprop-2-enoxy)ethyl]ethane-1,2-diamine (PubChem CID 114466320) has the molecular formula C8H18N2O and a molecular weight of 158.25 g/mol. Its IUPAC name is N'-[2-(2-methylprop-2-enoxy)ethyl]ethane-1,2-diamine.
| Compound Name | N'-[2-(2-methylprop-2-enoxy)ethyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 114466320 |
| Molecular Formula | C8H18N2O |
| Molecular Weight | 158.25 g/mol |
| Exact Mass | 158.14 |
| IUPAC Name | N'-[2-(2-methylprop-2-enoxy)ethyl]ethane-1,2-diamine |
| SMILES | C=C(C)COCCNCCN |
| InChI | InChI=1S/C8H18N2O/c1-8(2)7-11-6-5-10-4-3-9/h10H,1,3-7,9H2,2H3 |
| InChIKey | QGPIPLMMNDVZQC-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.25 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|