C11H24N2O — CID 114466339
3-methyl-2-N-[2-(2-methylprop-2-enoxy)ethyl]butane-1,2-diamine (PubChem CID 114466339) has the molecular formula C11H24N2O and a molecular weight of 200.33 g/mol. Its IUPAC name is 3-methyl-2-N-[2-(2-methylprop-2-enoxy)ethyl]butane-1,2-diamine.
| Compound Name | 3-methyl-2-N-[2-(2-methylprop-2-enoxy)ethyl]butane-1,2-diamine |
|---|---|
| PubChem CID | 114466339 |
| Molecular Formula | C11H24N2O |
| Molecular Weight | 200.33 g/mol |
| Exact Mass | 200.19 |
| IUPAC Name | 3-methyl-2-N-[2-(2-methylprop-2-enoxy)ethyl]butane-1,2-diamine |
| SMILES | C=C(C)COCCNC(CN)C(C)C |
| InChI | InChI=1S/C11H24N2O/c1-9(2)8-14-6-5-13-11(7-12)10(3)4/h10-11,13H,1,5-8,12H2,2-4H3 |
| InChIKey | IJCJEBBWPRYMHV-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.33 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|