About 3,3-dimethyl-2-N-[2-(2-methylprop-2-enoxy)ethyl]butane-1,2-diamine
3,3-dimethyl-2-N-[2-(2-methylprop-2-enoxy)ethyl]butane-1,2-diamine (PubChem CID 114466367) has the molecular formula C12H26N2O
and a molecular weight of 214.35 g/mol. Its IUPAC name is 3,3-dimethyl-2-N-[2-(2-methylprop-2-enoxy)ethyl]butane-1,2-diamine.
Molecular Properties
| Compound Name | 3,3-dimethyl-2-N-[2-(2-methylprop-2-enoxy)ethyl]butane-1,2-diamine |
| PubChem CID | 114466367 |
| Molecular Formula | C12H26N2O |
| Molecular Weight | 214.35 g/mol |
| Exact Mass | 214.20 |
| IUPAC Name | 3,3-dimethyl-2-N-[2-(2-methylprop-2-enoxy)ethyl]butane-1,2-diamine |
| SMILES | C=C(C)COCCNC(CN)C(C)(C)C |
| InChI | InChI=1S/C12H26N2O/c1-10(2)9-15-7-6-14-11(8-13)12(3,4)5/h11,14H,1,6-9,13H2,2-5H3 |
| InChIKey | KWBVUMLSNFFOAV-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.35 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3,3-dimethyl-2-N-[2-(2-methylprop-2-enoxy)ethyl]butane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-dimethyl-2-N-[2-(2-methylprop-2-enoxy)ethyl]butane-1,2-diamine?
The IUPAC name of 3,3-dimethyl-2-N-[2-(2-methylprop-2-enoxy)ethyl]butane-1,2-diamine (CID 114466367) is 3,3-dimethyl-2-N-[2-(2-methylprop-2-enoxy)ethyl]butane-1,2-diamine.
What is the SMILES notation for 3,3-dimethyl-2-N-[2-(2-methylprop-2-enoxy)ethyl]butane-1,2-diamine?
The canonical SMILES for 3,3-dimethyl-2-N-[2-(2-methylprop-2-enoxy)ethyl]butane-1,2-diamine is C=C(C)COCCNC(CN)C(C)(C)C.
What is the InChIKey of 3,3-dimethyl-2-N-[2-(2-methylprop-2-enoxy)ethyl]butane-1,2-diamine?
The InChIKey is KWBVUMLSNFFOAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H26N2O/c1-10(2)9-15-7-6-14-11(8-13)12(3,4)5/h11,14H,1,6-9,13H2,2-5H3.
What are the key properties of 3,3-dimethyl-2-N-[2-(2-methylprop-2-enoxy)ethyl]butane-1,2-diamine?
3,3-dimethyl-2-N-[2-(2-methylprop-2-enoxy)ethyl]butane-1,2-diamine has a molecular weight of 214.35 g/mol, XLogP of 1.54, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-dimethyl-2-N-[2-(2-methylprop-2-enoxy)ethyl]butane-1,2-diamine is sourced from PubChem (CID 114466367), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).