About 2-N-[2-(2-methylprop-2-enoxy)ethyl]-4-methylsulfanylbutane-1,2-diamine
2-N-[2-(2-methylprop-2-enoxy)ethyl]-4-methylsulfanylbutane-1,2-diamine (PubChem CID 114466427) has the molecular formula C11H24N2OS
and a molecular weight of 232.39 g/mol. Its IUPAC name is 2-N-[2-(2-methylprop-2-enoxy)ethyl]-4-methylsulfanylbutane-1,2-diamine.
Molecular Properties
| Compound Name | 2-N-[2-(2-methylprop-2-enoxy)ethyl]-4-methylsulfanylbutane-1,2-diamine |
| PubChem CID | 114466427 |
| Molecular Formula | C11H24N2OS |
| Molecular Weight | 232.39 g/mol |
| Exact Mass | 232.16 |
| IUPAC Name | 2-N-[2-(2-methylprop-2-enoxy)ethyl]-4-methylsulfanylbutane-1,2-diamine |
| SMILES | C=C(C)COCCNC(CN)CCSC |
| InChI | InChI=1S/C11H24N2OS/c1-10(2)9-14-6-5-13-11(8-12)4-7-15-3/h11,13H,1,4-9,12H2,2-3H3 |
| InChIKey | WCKRULZCQCDVQA-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.39 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-N-[2-(2-methylprop-2-enoxy)ethyl]-4-methylsulfanylbutane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-N-[2-(2-methylprop-2-enoxy)ethyl]-4-methylsulfanylbutane-1,2-diamine?
The IUPAC name of 2-N-[2-(2-methylprop-2-enoxy)ethyl]-4-methylsulfanylbutane-1,2-diamine (CID 114466427) is 2-N-[2-(2-methylprop-2-enoxy)ethyl]-4-methylsulfanylbutane-1,2-diamine.
What is the SMILES notation for 2-N-[2-(2-methylprop-2-enoxy)ethyl]-4-methylsulfanylbutane-1,2-diamine?
The canonical SMILES for 2-N-[2-(2-methylprop-2-enoxy)ethyl]-4-methylsulfanylbutane-1,2-diamine is C=C(C)COCCNC(CN)CCSC.
What is the InChIKey of 2-N-[2-(2-methylprop-2-enoxy)ethyl]-4-methylsulfanylbutane-1,2-diamine?
The InChIKey is WCKRULZCQCDVQA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H24N2OS/c1-10(2)9-14-6-5-13-11(8-12)4-7-15-3/h11,13H,1,4-9,12H2,2-3H3.
What are the key properties of 2-N-[2-(2-methylprop-2-enoxy)ethyl]-4-methylsulfanylbutane-1,2-diamine?
2-N-[2-(2-methylprop-2-enoxy)ethyl]-4-methylsulfanylbutane-1,2-diamine has a molecular weight of 232.39 g/mol, XLogP of 1.25, 10 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-N-[2-(2-methylprop-2-enoxy)ethyl]-4-methylsulfanylbutane-1,2-diamine is sourced from PubChem (CID 114466427), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).