C15H30N2O2 — CID 114466544
3-(aminomethyl)-2,2,5,5-tetramethyl-N-[2-(2-methylprop-2-enoxy)ethyl]oxolan-3-amine (PubChem CID 114466544) has the molecular formula C15H30N2O2 and a molecular weight of 270.42 g/mol. Its IUPAC name is 3-(aminomethyl)-2,2,5,5-tetramethyl-N-[2-(2-methylprop-2-enoxy)ethyl]oxolan-3-amine.
| Compound Name | 3-(aminomethyl)-2,2,5,5-tetramethyl-N-[2-(2-methylprop-2-enoxy)ethyl]oxolan-3-amine |
|---|---|
| PubChem CID | 114466544 |
| Molecular Formula | C15H30N2O2 |
| Molecular Weight | 270.42 g/mol |
| Exact Mass | 270.23 |
| IUPAC Name | 3-(aminomethyl)-2,2,5,5-tetramethyl-N-[2-(2-methylprop-2-enoxy)ethyl]oxolan-3-amine |
| SMILES | C=C(C)COCCNC1(CN)CC(C)(C)OC1(C)C |
| InChI | InChI=1S/C15H30N2O2/c1-12(2)9-18-8-7-17-15(11-16)10-13(3,4)19-14(15,5)6/h17H,1,7-11,16H2,2-6H3 |
| InChIKey | UWQZGEZTZRUZPZ-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.42 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|