C12H24N2O2 — CID 114466636
3-(aminomethyl)-2-methyl-N-[2-(2-methylprop-2-enoxy)ethyl]oxolan-3-amine (PubChem CID 114466636) has the molecular formula C12H24N2O2 and a molecular weight of 228.34 g/mol. Its IUPAC name is 3-(aminomethyl)-2-methyl-N-[2-(2-methylprop-2-enoxy)ethyl]oxolan-3-amine.
| Compound Name | 3-(aminomethyl)-2-methyl-N-[2-(2-methylprop-2-enoxy)ethyl]oxolan-3-amine |
|---|---|
| PubChem CID | 114466636 |
| Molecular Formula | C12H24N2O2 |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.18 |
| IUPAC Name | 3-(aminomethyl)-2-methyl-N-[2-(2-methylprop-2-enoxy)ethyl]oxolan-3-amine |
| SMILES | C=C(C)COCCNC1(CN)CCOC1C |
| InChI | InChI=1S/C12H24N2O2/c1-10(2)8-15-7-5-14-12(9-13)4-6-16-11(12)3/h11,14H,1,4-9,13H2,2-3H3 |
| InChIKey | CXUIGQFESUTUFC-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|