C11H20N2O — CID 114467440
N-[2-(2-methylprop-2-enoxy)ethyl]-2,3,4,5-tetrahydropyridin-6-amine (PubChem CID 114467440) has the molecular formula C11H20N2O and a molecular weight of 196.29 g/mol. Its IUPAC name is N-[2-(2-methylprop-2-enoxy)ethyl]-2,3,4,5-tetrahydropyridin-6-amine.
| Compound Name | N-[2-(2-methylprop-2-enoxy)ethyl]-2,3,4,5-tetrahydropyridin-6-amine |
|---|---|
| PubChem CID | 114467440 |
| Molecular Formula | C11H20N2O |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.16 |
| IUPAC Name | N-[2-(2-methylprop-2-enoxy)ethyl]-2,3,4,5-tetrahydropyridin-6-amine |
| SMILES | C=C(C)COCCNC1=NCCCC1 |
| InChI | InChI=1S/C11H20N2O/c1-10(2)9-14-8-7-13-11-5-3-4-6-12-11/h1,3-9H2,2H3,(H,12,13) |
| InChIKey | LISDZTMRCZEUCG-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|