About 3-[[(1S,4R)-7-bicyclo[2.2.1]hept-2-enyl]oxy]-3-chlorodiazirine
3-[[(1S,4R)-7-bicyclo[2.2.1]hept-2-enyl]oxy]-3-chlorodiazirine (PubChem CID 11446752) has the molecular formula C8H9ClN2O
and a molecular weight of 184.63 g/mol. Its IUPAC name is 3-[[(1S,4R)-7-bicyclo[2.2.1]hept-2-enyl]oxy]-3-chlorodiazirine.
Molecular Properties
| Compound Name | 3-[[(1S,4R)-7-bicyclo[2.2.1]hept-2-enyl]oxy]-3-chlorodiazirine |
| PubChem CID | 11446752 |
| Molecular Formula | C8H9ClN2O |
| Molecular Weight | 184.63 g/mol |
| Exact Mass | 184.04 |
| IUPAC Name | 3-[[(1S,4R)-7-bicyclo[2.2.1]hept-2-enyl]oxy]-3-chlorodiazirine |
| SMILES | ClC1(OC2[C@@H]3C=C[C@H]2CC3)N=N1 |
| InChI | InChI=1S/C8H9ClN2O/c9-8(10-11-8)12-7-5-1-2-6(7)4-3-5/h1-2,5-7H,3-4H2/t5-,6+,7? |
| InChIKey | AHGWYRVVMSTEDZ-MEKDEQNOSA-N |
| XLogP | 2.28 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.63 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 3-[[(1S,4R)-7-bicyclo[2.2.1]hept-2-enyl]oxy]-3-chlorodiazirine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[(1S,4R)-7-bicyclo[2.2.1]hept-2-enyl]oxy]-3-chlorodiazirine?
The IUPAC name of 3-[[(1S,4R)-7-bicyclo[2.2.1]hept-2-enyl]oxy]-3-chlorodiazirine (CID 11446752) is 3-[[(1S,4R)-7-bicyclo[2.2.1]hept-2-enyl]oxy]-3-chlorodiazirine.
What is the SMILES notation for 3-[[(1S,4R)-7-bicyclo[2.2.1]hept-2-enyl]oxy]-3-chlorodiazirine?
The canonical SMILES for 3-[[(1S,4R)-7-bicyclo[2.2.1]hept-2-enyl]oxy]-3-chlorodiazirine is ClC1(OC2[C@@H]3C=C[C@H]2CC3)N=N1.
What is the InChIKey of 3-[[(1S,4R)-7-bicyclo[2.2.1]hept-2-enyl]oxy]-3-chlorodiazirine?
The InChIKey is AHGWYRVVMSTEDZ-MEKDEQNOSA-N. The full InChI is InChI=1S/C8H9ClN2O/c9-8(10-11-8)12-7-5-1-2-6(7)4-3-5/h1-2,5-7H,3-4H2/t5-,6+,7?.
What are the key properties of 3-[[(1S,4R)-7-bicyclo[2.2.1]hept-2-enyl]oxy]-3-chlorodiazirine?
3-[[(1S,4R)-7-bicyclo[2.2.1]hept-2-enyl]oxy]-3-chlorodiazirine has a molecular weight of 184.63 g/mol, XLogP of 2.28, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[(1S,4R)-7-bicyclo[2.2.1]hept-2-enyl]oxy]-3-chlorodiazirine is sourced from PubChem (CID 11446752), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).