About 5-bromo-2,3-dimethylpyridine
5-bromo-2,3-dimethylpyridine (PubChem CID 11446762) has the molecular formula C7H8BrN
and a molecular weight of 186.05 g/mol. Its IUPAC name is 5-bromo-2,3-dimethylpyridine.
Molecular Properties
| Compound Name | 5-bromo-2,3-dimethylpyridine |
| PubChem CID | 11446762 |
| Molecular Formula | C7H8BrN |
| Molecular Weight | 186.05 g/mol |
| Exact Mass | 184.98 |
| IUPAC Name | 5-bromo-2,3-dimethylpyridine |
| SMILES | Cc1cc(Br)cnc1C |
| InChI | InChI=1S/C7H8BrN/c1-5-3-7(8)4-9-6(5)2/h3-4H,1-2H3 |
| InChIKey | PVWAMZCIAHXKJP-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.05 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-bromo-2,3-dimethylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-2,3-dimethylpyridine?
The IUPAC name of 5-bromo-2,3-dimethylpyridine (CID 11446762) is 5-bromo-2,3-dimethylpyridine.
What is the SMILES notation for 5-bromo-2,3-dimethylpyridine?
The canonical SMILES for 5-bromo-2,3-dimethylpyridine is Cc1cc(Br)cnc1C.
What is the InChIKey of 5-bromo-2,3-dimethylpyridine?
The InChIKey is PVWAMZCIAHXKJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8BrN/c1-5-3-7(8)4-9-6(5)2/h3-4H,1-2H3.
What are the key properties of 5-bromo-2,3-dimethylpyridine?
5-bromo-2,3-dimethylpyridine has a molecular weight of 186.05 g/mol, XLogP of 2.46, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-2,3-dimethylpyridine is sourced from PubChem (CID 11446762), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).