About methyl 2-hept-6-enoxyacetate
methyl 2-hept-6-enoxyacetate (PubChem CID 11446767) has the molecular formula C10H18O3
and a molecular weight of 186.25 g/mol. Its IUPAC name is methyl 2-hept-6-enoxyacetate.
Molecular Properties
| Compound Name | methyl 2-hept-6-enoxyacetate |
| PubChem CID | 11446767 |
| Molecular Formula | C10H18O3 |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.13 |
| IUPAC Name | methyl 2-hept-6-enoxyacetate |
| SMILES | C=CCCCCCOCC(=O)OC |
| InChI | InChI=1S/C10H18O3/c1-3-4-5-6-7-8-13-9-10(11)12-2/h3H,1,4-9H2,2H3 |
| InChIKey | KAUBWLTVFBSVAX-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-hept-6-enoxyacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-hept-6-enoxyacetate?
The IUPAC name of methyl 2-hept-6-enoxyacetate (CID 11446767) is methyl 2-hept-6-enoxyacetate.
What is the SMILES notation for methyl 2-hept-6-enoxyacetate?
The canonical SMILES for methyl 2-hept-6-enoxyacetate is C=CCCCCCOCC(=O)OC.
What is the InChIKey of methyl 2-hept-6-enoxyacetate?
The InChIKey is KAUBWLTVFBSVAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18O3/c1-3-4-5-6-7-8-13-9-10(11)12-2/h3H,1,4-9H2,2H3.
What are the key properties of methyl 2-hept-6-enoxyacetate?
methyl 2-hept-6-enoxyacetate has a molecular weight of 186.25 g/mol, XLogP of 1.92, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-hept-6-enoxyacetate is sourced from PubChem (CID 11446767), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).