C10H22N2O — CID 114467742
N',N'-dimethyl-N-[2-(2-methylprop-2-enoxy)ethyl]ethane-1,2-diamine (PubChem CID 114467742) has the molecular formula C10H22N2O and a molecular weight of 186.30 g/mol. Its IUPAC name is N',N'-dimethyl-N-[2-(2-methylprop-2-enoxy)ethyl]ethane-1,2-diamine.
| Compound Name | N',N'-dimethyl-N-[2-(2-methylprop-2-enoxy)ethyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 114467742 |
| Molecular Formula | C10H22N2O |
| Molecular Weight | 186.30 g/mol |
| Exact Mass | 186.17 |
| IUPAC Name | N',N'-dimethyl-N-[2-(2-methylprop-2-enoxy)ethyl]ethane-1,2-diamine |
| SMILES | C=C(C)COCCNCCN(C)C |
| InChI | InChI=1S/C10H22N2O/c1-10(2)9-13-8-6-11-5-7-12(3)4/h11H,1,5-9H2,2-4H3 |
| InChIKey | FBJZICPZGQPVDP-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.30 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|