About 6-phenylsulfanyl-3,4-dihydro-2H-pyran
6-phenylsulfanyl-3,4-dihydro-2H-pyran (PubChem CID 11446848) has the molecular formula C11H12OS
and a molecular weight of 192.28 g/mol. Its IUPAC name is 6-phenylsulfanyl-3,4-dihydro-2H-pyran.
Molecular Properties
| Compound Name | 6-phenylsulfanyl-3,4-dihydro-2H-pyran |
| PubChem CID | 11446848 |
| Molecular Formula | C11H12OS |
| Molecular Weight | 192.28 g/mol |
| Exact Mass | 192.06 |
| IUPAC Name | 6-phenylsulfanyl-3,4-dihydro-2H-pyran |
| SMILES | C1=C(Sc2ccccc2)OCCC1 |
| InChI | InChI=1S/C11H12OS/c1-2-6-10(7-3-1)13-11-8-4-5-9-12-11/h1-3,6-8H,4-5,9H2 |
| InChIKey | KQNKZCLHOHJSEJ-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.28 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-phenylsulfanyl-3,4-dihydro-2H-pyran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-phenylsulfanyl-3,4-dihydro-2H-pyran?
The IUPAC name of 6-phenylsulfanyl-3,4-dihydro-2H-pyran (CID 11446848) is 6-phenylsulfanyl-3,4-dihydro-2H-pyran.
What is the SMILES notation for 6-phenylsulfanyl-3,4-dihydro-2H-pyran?
The canonical SMILES for 6-phenylsulfanyl-3,4-dihydro-2H-pyran is C1=C(Sc2ccccc2)OCCC1.
What is the InChIKey of 6-phenylsulfanyl-3,4-dihydro-2H-pyran?
The InChIKey is KQNKZCLHOHJSEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12OS/c1-2-6-10(7-3-1)13-11-8-4-5-9-12-11/h1-3,6-8H,4-5,9H2.
What are the key properties of 6-phenylsulfanyl-3,4-dihydro-2H-pyran?
6-phenylsulfanyl-3,4-dihydro-2H-pyran has a molecular weight of 192.28 g/mol, XLogP of 3.43, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-phenylsulfanyl-3,4-dihydro-2H-pyran is sourced from PubChem (CID 11446848), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).