About 1,2-bis(methoxymethyl)-4,5-dimethylcyclohexa-1,4-diene
1,2-bis(methoxymethyl)-4,5-dimethylcyclohexa-1,4-diene (PubChem CID 11446903) has the molecular formula C12H20O2
and a molecular weight of 196.29 g/mol. Its IUPAC name is 1,2-bis(methoxymethyl)-4,5-dimethylcyclohexa-1,4-diene.
Molecular Properties
| Compound Name | 1,2-bis(methoxymethyl)-4,5-dimethylcyclohexa-1,4-diene |
| PubChem CID | 11446903 |
| Molecular Formula | C12H20O2 |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.15 |
| IUPAC Name | 1,2-bis(methoxymethyl)-4,5-dimethylcyclohexa-1,4-diene |
| SMILES | COCC1=C(COC)CC(C)=C(C)C1 |
| InChI | InChI=1S/C12H20O2/c1-9-5-11(7-13-3)12(8-14-4)6-10(9)2/h5-8H2,1-4H3 |
| InChIKey | CCYJMYMXDPCABM-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1,2-bis(methoxymethyl)-4,5-dimethylcyclohexa-1,4-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-bis(methoxymethyl)-4,5-dimethylcyclohexa-1,4-diene?
The IUPAC name of 1,2-bis(methoxymethyl)-4,5-dimethylcyclohexa-1,4-diene (CID 11446903) is 1,2-bis(methoxymethyl)-4,5-dimethylcyclohexa-1,4-diene.
What is the SMILES notation for 1,2-bis(methoxymethyl)-4,5-dimethylcyclohexa-1,4-diene?
The canonical SMILES for 1,2-bis(methoxymethyl)-4,5-dimethylcyclohexa-1,4-diene is COCC1=C(COC)CC(C)=C(C)C1.
What is the InChIKey of 1,2-bis(methoxymethyl)-4,5-dimethylcyclohexa-1,4-diene?
The InChIKey is CCYJMYMXDPCABM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20O2/c1-9-5-11(7-13-3)12(8-14-4)6-10(9)2/h5-8H2,1-4H3.
What are the key properties of 1,2-bis(methoxymethyl)-4,5-dimethylcyclohexa-1,4-diene?
1,2-bis(methoxymethyl)-4,5-dimethylcyclohexa-1,4-diene has a molecular weight of 196.29 g/mol, XLogP of 2.71, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-bis(methoxymethyl)-4,5-dimethylcyclohexa-1,4-diene is sourced from PubChem (CID 11446903), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).