About [(1S)-1-cyclohexylethyl] butanoate
[(1S)-1-cyclohexylethyl] butanoate (PubChem CID 11446946) has the molecular formula C12H22O2
and a molecular weight of 198.31 g/mol. Its IUPAC name is [(1S)-1-cyclohexylethyl] butanoate.
Molecular Properties
| Compound Name | [(1S)-1-cyclohexylethyl] butanoate |
| PubChem CID | 11446946 |
| Molecular Formula | C12H22O2 |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.16 |
| IUPAC Name | [(1S)-1-cyclohexylethyl] butanoate |
| SMILES | CCCC(=O)O[C@@H](C)C1CCCCC1 |
| InChI | InChI=1S/C12H22O2/c1-3-7-12(13)14-10(2)11-8-5-4-6-9-11/h10-11H,3-9H2,1-2H3/t10-/m0/s1 |
| InChIKey | FTMSYMOBBRINAR-JTQLQIEISA-N |
| XLogP | 3.30 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [(1S)-1-cyclohexylethyl] butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S)-1-cyclohexylethyl] butanoate?
The IUPAC name of [(1S)-1-cyclohexylethyl] butanoate (CID 11446946) is [(1S)-1-cyclohexylethyl] butanoate.
What is the SMILES notation for [(1S)-1-cyclohexylethyl] butanoate?
The canonical SMILES for [(1S)-1-cyclohexylethyl] butanoate is CCCC(=O)O[C@@H](C)C1CCCCC1.
What is the InChIKey of [(1S)-1-cyclohexylethyl] butanoate?
The InChIKey is FTMSYMOBBRINAR-JTQLQIEISA-N. The full InChI is InChI=1S/C12H22O2/c1-3-7-12(13)14-10(2)11-8-5-4-6-9-11/h10-11H,3-9H2,1-2H3/t10-/m0/s1.
What are the key properties of [(1S)-1-cyclohexylethyl] butanoate?
[(1S)-1-cyclohexylethyl] butanoate has a molecular weight of 198.31 g/mol, XLogP of 3.30, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S)-1-cyclohexylethyl] butanoate is sourced from PubChem (CID 11446946), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).