C11H12BrNO3 — CID 114469984
5-bromo-2-(3-methylbut-3-enoxy)pyridine-3-carboxylic acid (PubChem CID 114469984) has the molecular formula C11H12BrNO3 and a molecular weight of 286.12 g/mol. Its IUPAC name is 5-bromo-2-(3-methylbut-3-enoxy)pyridine-3-carboxylic acid.
| Compound Name | 5-bromo-2-(3-methylbut-3-enoxy)pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 114469984 |
| Molecular Formula | C11H12BrNO3 |
| Molecular Weight | 286.12 g/mol |
| Exact Mass | 285.00 |
| IUPAC Name | 5-bromo-2-(3-methylbut-3-enoxy)pyridine-3-carboxylic acid |
| SMILES | C=C(C)CCOc1ncc(Br)cc1C(=O)O |
| InChI | InChI=1S/C11H12BrNO3/c1-7(2)3-4-16-10-9(11(14)15)5-8(12)6-13-10/h5-6H,1,3-4H2,2H3,(H,14,15) |
| InChIKey | QJNNJHRBIGNMKP-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.12 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|