About 2-tert-butyl-1,2,4-benzotriazin-3-one
2-tert-butyl-1,2,4-benzotriazin-3-one (PubChem CID 11447027) has the molecular formula C11H13N3O
and a molecular weight of 203.25 g/mol. Its IUPAC name is 2-tert-butyl-1,2,4-benzotriazin-3-one.
Molecular Properties
| Compound Name | 2-tert-butyl-1,2,4-benzotriazin-3-one |
| PubChem CID | 11447027 |
| Molecular Formula | C11H13N3O |
| Molecular Weight | 203.25 g/mol |
| Exact Mass | 203.11 |
| IUPAC Name | 2-tert-butyl-1,2,4-benzotriazin-3-one |
| SMILES | CC(C)(C)n1nc2ccccc2nc1=O |
| InChI | InChI=1S/C11H13N3O/c1-11(2,3)14-10(15)12-8-6-4-5-7-9(8)13-14/h4-7H,1-3H3 |
| InChIKey | XVHGKZFDSVECEK-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.25 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-tert-butyl-1,2,4-benzotriazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tert-butyl-1,2,4-benzotriazin-3-one?
The IUPAC name of 2-tert-butyl-1,2,4-benzotriazin-3-one (CID 11447027) is 2-tert-butyl-1,2,4-benzotriazin-3-one.
What is the SMILES notation for 2-tert-butyl-1,2,4-benzotriazin-3-one?
The canonical SMILES for 2-tert-butyl-1,2,4-benzotriazin-3-one is CC(C)(C)n1nc2ccccc2nc1=O.
What is the InChIKey of 2-tert-butyl-1,2,4-benzotriazin-3-one?
The InChIKey is XVHGKZFDSVECEK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13N3O/c1-11(2,3)14-10(15)12-8-6-4-5-7-9(8)13-14/h4-7H,1-3H3.
What are the key properties of 2-tert-butyl-1,2,4-benzotriazin-3-one?
2-tert-butyl-1,2,4-benzotriazin-3-one has a molecular weight of 203.25 g/mol, XLogP of 1.55, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tert-butyl-1,2,4-benzotriazin-3-one is sourced from PubChem (CID 11447027), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).