C12H20O3 — CID 11447184
(1R,2R,5S)-2-[(1R)-1-(1,3-dioxolan-2-yl)ethyl]-5-methylcyclopentane-1-carbaldehyde (PubChem CID 11447184) has the molecular formula C12H20O3 and a molecular weight of 212.29 g/mol. Its IUPAC name is (1R,2R,5S)-2-[(1R)-1-(1,3-dioxolan-2-yl)ethyl]-5-methylcyclopentane-1-carbaldehyde.
| Compound Name | (1R,2R,5S)-2-[(1R)-1-(1,3-dioxolan-2-yl)ethyl]-5-methylcyclopentane-1-carbaldehyde |
|---|---|
| PubChem CID | 11447184 |
| Molecular Formula | C12H20O3 |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.14 |
| IUPAC Name | (1R,2R,5S)-2-[(1R)-1-(1,3-dioxolan-2-yl)ethyl]-5-methylcyclopentane-1-carbaldehyde |
| SMILES | C[C@H]1CC[C@H]([C@@H](C)C2OCCO2)[C@@H]1C=O |
| InChI | InChI=1S/C12H20O3/c1-8-3-4-10(11(8)7-13)9(2)12-14-5-6-15-12/h7-12H,3-6H2,1-2H3/t8-,9+,10+,11+/m0/s1 |
| InChIKey | MRNFTTCGBMNQJY-LNFKQOIKSA-N |
| XLogP | 1.86 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|