C10H16N2O2 — CID 114472384
3-(3-methylbut-3-enylamino)piperidine-2,6-dione (PubChem CID 114472384) has the molecular formula C10H16N2O2 and a molecular weight of 196.25 g/mol. Its IUPAC name is 3-(3-methylbut-3-enylamino)piperidine-2,6-dione.
| Compound Name | 3-(3-methylbut-3-enylamino)piperidine-2,6-dione |
|---|---|
| PubChem CID | 114472384 |
| Molecular Formula | C10H16N2O2 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.12 |
| IUPAC Name | 3-(3-methylbut-3-enylamino)piperidine-2,6-dione |
| SMILES | C=C(C)CCNC1CCC(=O)NC1=O |
| InChI | InChI=1S/C10H16N2O2/c1-7(2)5-6-11-8-3-4-9(13)12-10(8)14/h8,11H,1,3-6H2,2H3,(H,12,13,14) |
| InChIKey | MNOFPOIVBBAHLI-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|