About 3-methoxy-2,7-dimethyloct-7-en-4-one
3-methoxy-2,7-dimethyloct-7-en-4-one (PubChem CID 114473740) has the molecular formula C11H20O2
and a molecular weight of 184.28 g/mol. Its IUPAC name is 3-methoxy-2,7-dimethyloct-7-en-4-one.
Molecular Properties
| Compound Name | 3-methoxy-2,7-dimethyloct-7-en-4-one |
| PubChem CID | 114473740 |
| Molecular Formula | C11H20O2 |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.15 |
| IUPAC Name | 3-methoxy-2,7-dimethyloct-7-en-4-one |
| SMILES | C=C(C)CCC(=O)C(OC)C(C)C |
| InChI | InChI=1S/C11H20O2/c1-8(2)6-7-10(12)11(13-5)9(3)4/h9,11H,1,6-7H2,2-5H3 |
| InChIKey | CKXQIMAIVFJAMV-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-methoxy-2,7-dimethyloct-7-en-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methoxy-2,7-dimethyloct-7-en-4-one?
The IUPAC name of 3-methoxy-2,7-dimethyloct-7-en-4-one (CID 114473740) is 3-methoxy-2,7-dimethyloct-7-en-4-one.
What is the SMILES notation for 3-methoxy-2,7-dimethyloct-7-en-4-one?
The canonical SMILES for 3-methoxy-2,7-dimethyloct-7-en-4-one is C=C(C)CCC(=O)C(OC)C(C)C.
What is the InChIKey of 3-methoxy-2,7-dimethyloct-7-en-4-one?
The InChIKey is CKXQIMAIVFJAMV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20O2/c1-8(2)6-7-10(12)11(13-5)9(3)4/h9,11H,1,6-7H2,2-5H3.
What are the key properties of 3-methoxy-2,7-dimethyloct-7-en-4-one?
3-methoxy-2,7-dimethyloct-7-en-4-one has a molecular weight of 184.28 g/mol, XLogP of 2.58, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methoxy-2,7-dimethyloct-7-en-4-one is sourced from PubChem (CID 114473740), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).