C14H29NO — CID 114473935
3-(diethylamino)-3,7-dimethyloct-7-en-4-ol (PubChem CID 114473935) has the molecular formula C14H29NO and a molecular weight of 227.39 g/mol. Its IUPAC name is 3-(diethylamino)-3,7-dimethyloct-7-en-4-ol.
| Compound Name | 3-(diethylamino)-3,7-dimethyloct-7-en-4-ol |
|---|---|
| PubChem CID | 114473935 |
| Molecular Formula | C14H29NO |
| Molecular Weight | 227.39 g/mol |
| Exact Mass | 227.22 |
| IUPAC Name | 3-(diethylamino)-3,7-dimethyloct-7-en-4-ol |
| SMILES | C=C(C)CCC(O)C(C)(CC)N(CC)CC |
| InChI | InChI=1S/C14H29NO/c1-7-14(6,15(8-2)9-3)13(16)11-10-12(4)5/h13,16H,4,7-11H2,1-3,5-6H3 |
| InChIKey | KRNVDMMWDGMFJL-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.39 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|