About bis(2,2,2-trifluoroethyl) carbonate
bis(2,2,2-trifluoroethyl) carbonate (PubChem CID 11447463) has the molecular formula C5H4F6O3
and a molecular weight of 226.07 g/mol. Its IUPAC name is bis(2,2,2-trifluoroethyl) carbonate.
Molecular Properties
| Compound Name | bis(2,2,2-trifluoroethyl) carbonate |
| PubChem CID | 11447463 |
| Molecular Formula | C5H4F6O3 |
| Molecular Weight | 226.07 g/mol |
| Exact Mass | 226.01 |
| IUPAC Name | bis(2,2,2-trifluoroethyl) carbonate |
| SMILES | O=C(OCC(F)(F)F)OCC(F)(F)F |
| InChI | InChI=1S/C5H4F6O3/c6-4(7,8)1-13-3(12)14-2-5(9,10)11/h1-2H2 |
| InChIKey | WLLOZRDOFANZMZ-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.07 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze bis(2,2,2-trifluoroethyl) carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2,2,2-trifluoroethyl) carbonate?
The IUPAC name of bis(2,2,2-trifluoroethyl) carbonate (CID 11447463) is bis(2,2,2-trifluoroethyl) carbonate.
What is the SMILES notation for bis(2,2,2-trifluoroethyl) carbonate?
The canonical SMILES for bis(2,2,2-trifluoroethyl) carbonate is O=C(OCC(F)(F)F)OCC(F)(F)F.
What is the InChIKey of bis(2,2,2-trifluoroethyl) carbonate?
The InChIKey is WLLOZRDOFANZMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4F6O3/c6-4(7,8)1-13-3(12)14-2-5(9,10)11/h1-2H2.
What are the key properties of bis(2,2,2-trifluoroethyl) carbonate?
bis(2,2,2-trifluoroethyl) carbonate has a molecular weight of 226.07 g/mol, XLogP of 2.26, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2,2,2-trifluoroethyl) carbonate is sourced from PubChem (CID 11447463), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).