C19H29N — CID 114474715
4-methyl-N-propyl-1-(1,2,3,4-tetrahydronaphthalen-1-yl)pent-4-en-1-amine (PubChem CID 114474715) has the molecular formula C19H29N and a molecular weight of 271.45 g/mol. Its IUPAC name is 4-methyl-N-propyl-1-(1,2,3,4-tetrahydronaphthalen-1-yl)pent-4-en-1-amine.
| Compound Name | 4-methyl-N-propyl-1-(1,2,3,4-tetrahydronaphthalen-1-yl)pent-4-en-1-amine |
|---|---|
| PubChem CID | 114474715 |
| Molecular Formula | C19H29N |
| Molecular Weight | 271.45 g/mol |
| Exact Mass | 271.23 |
| IUPAC Name | 4-methyl-N-propyl-1-(1,2,3,4-tetrahydronaphthalen-1-yl)pent-4-en-1-amine |
| SMILES | C=C(C)CCC(NCCC)C1CCCc2ccccc21 |
| InChI | InChI=1S/C19H29N/c1-4-14-20-19(13-12-15(2)3)18-11-7-9-16-8-5-6-10-17(16)18/h5-6,8,10,18-20H,2,4,7,9,11-14H2,1,3H3 |
| InChIKey | OVLMHXWXBBNKIZ-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.45 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|