About [1-(5,6-dimethylpyrazin-2-yl)-4-methylsulfanylpiperidin-4-yl]methanamine
[1-(5,6-dimethylpyrazin-2-yl)-4-methylsulfanylpiperidin-4-yl]methanamine (PubChem CID 114474796) has the molecular formula C13H22N4S
and a molecular weight of 266.41 g/mol. Its IUPAC name is [1-(5,6-dimethylpyrazin-2-yl)-4-methylsulfanylpiperidin-4-yl]methanamine.
Molecular Properties
| Compound Name | [1-(5,6-dimethylpyrazin-2-yl)-4-methylsulfanylpiperidin-4-yl]methanamine |
| PubChem CID | 114474796 |
| Molecular Formula | C13H22N4S |
| Molecular Weight | 266.41 g/mol |
| Exact Mass | 266.16 |
| IUPAC Name | [1-(5,6-dimethylpyrazin-2-yl)-4-methylsulfanylpiperidin-4-yl]methanamine |
| SMILES | CSC1(CN)CCN(c2cnc(C)c(C)n2)CC1 |
| InChI | InChI=1S/C13H22N4S/c1-10-11(2)16-12(8-15-10)17-6-4-13(9-14,18-3)5-7-17/h8H,4-7,9,14H2,1-3H3 |
| InChIKey | XLRHWLZHPMIEPM-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.41 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [1-(5,6-dimethylpyrazin-2-yl)-4-methylsulfanylpiperidin-4-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(5,6-dimethylpyrazin-2-yl)-4-methylsulfanylpiperidin-4-yl]methanamine?
The IUPAC name of [1-(5,6-dimethylpyrazin-2-yl)-4-methylsulfanylpiperidin-4-yl]methanamine (CID 114474796) is [1-(5,6-dimethylpyrazin-2-yl)-4-methylsulfanylpiperidin-4-yl]methanamine.
What is the SMILES notation for [1-(5,6-dimethylpyrazin-2-yl)-4-methylsulfanylpiperidin-4-yl]methanamine?
The canonical SMILES for [1-(5,6-dimethylpyrazin-2-yl)-4-methylsulfanylpiperidin-4-yl]methanamine is CSC1(CN)CCN(c2cnc(C)c(C)n2)CC1.
What is the InChIKey of [1-(5,6-dimethylpyrazin-2-yl)-4-methylsulfanylpiperidin-4-yl]methanamine?
The InChIKey is XLRHWLZHPMIEPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22N4S/c1-10-11(2)16-12(8-15-10)17-6-4-13(9-14,18-3)5-7-17/h8H,4-7,9,14H2,1-3H3.
What are the key properties of [1-(5,6-dimethylpyrazin-2-yl)-4-methylsulfanylpiperidin-4-yl]methanamine?
[1-(5,6-dimethylpyrazin-2-yl)-4-methylsulfanylpiperidin-4-yl]methanamine has a molecular weight of 266.41 g/mol, XLogP of 1.75, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(5,6-dimethylpyrazin-2-yl)-4-methylsulfanylpiperidin-4-yl]methanamine is sourced from PubChem (CID 114474796), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).