C11H16N2O2S — CID 114474956
methyl 3-(5,6-dimethylpyrazin-2-yl)sulfanylbutanoate (PubChem CID 114474956) has the molecular formula C11H16N2O2S and a molecular weight of 240.33 g/mol. Its IUPAC name is methyl 3-(5,6-dimethylpyrazin-2-yl)sulfanylbutanoate.
| Compound Name | methyl 3-(5,6-dimethylpyrazin-2-yl)sulfanylbutanoate |
|---|---|
| PubChem CID | 114474956 |
| Molecular Formula | C11H16N2O2S |
| Molecular Weight | 240.33 g/mol |
| Exact Mass | 240.09 |
| IUPAC Name | methyl 3-(5,6-dimethylpyrazin-2-yl)sulfanylbutanoate |
| SMILES | COC(=O)CC(C)Sc1cnc(C)c(C)n1 |
| InChI | InChI=1S/C11H16N2O2S/c1-7(5-11(14)15-4)16-10-6-12-8(2)9(3)13-10/h6-7H,5H2,1-4H3 |
| InChIKey | TYZPDAYJAKZXDU-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.33 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |