C12H16Cl2N2 — CID 114475430
1-(3,5-dichloro-2-pyridinyl)-N,4-dimethylpent-4-en-1-amine (PubChem CID 114475430) has the molecular formula C12H16Cl2N2 and a molecular weight of 259.18 g/mol. Its IUPAC name is 1-(3,5-dichloro-2-pyridinyl)-N,4-dimethylpent-4-en-1-amine.
| Compound Name | 1-(3,5-dichloro-2-pyridinyl)-N,4-dimethylpent-4-en-1-amine |
|---|---|
| PubChem CID | 114475430 |
| Molecular Formula | C12H16Cl2N2 |
| Molecular Weight | 259.18 g/mol |
| Exact Mass | 258.07 |
| IUPAC Name | 1-(3,5-dichloro-2-pyridinyl)-N,4-dimethylpent-4-en-1-amine |
| SMILES | C=C(C)CCC(NC)c1ncc(Cl)cc1Cl |
| InChI | InChI=1S/C12H16Cl2N2/c1-8(2)4-5-11(15-3)12-10(14)6-9(13)7-16-12/h6-7,11,15H,1,4-5H2,2-3H3 |
| InChIKey | XCRUGVAVEJDPMS-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.18 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|