C13H22N4 — CID 114475474
N-(1-ethylpiperidin-3-yl)-5,6-dimethylpyrazin-2-amine (PubChem CID 114475474) has the molecular formula C13H22N4 and a molecular weight of 234.35 g/mol. Its IUPAC name is N-(1-ethylpiperidin-3-yl)-5,6-dimethylpyrazin-2-amine.
| Compound Name | N-(1-ethylpiperidin-3-yl)-5,6-dimethylpyrazin-2-amine |
|---|---|
| PubChem CID | 114475474 |
| Molecular Formula | C13H22N4 |
| Molecular Weight | 234.35 g/mol |
| Exact Mass | 234.18 |
| IUPAC Name | N-(1-ethylpiperidin-3-yl)-5,6-dimethylpyrazin-2-amine |
| SMILES | CCN1CCCC(Nc2cnc(C)c(C)n2)C1 |
| InChI | InChI=1S/C13H22N4/c1-4-17-7-5-6-12(9-17)16-13-8-14-10(2)11(3)15-13/h8,12H,4-7,9H2,1-3H3,(H,15,16) |
| InChIKey | NGIYFBDBMVMYMG-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.35 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |