C18H35NO — CID 114476115
1-(1-ethoxy-4,4-dimethylcyclohexyl)-N-ethyl-4-methylpent-4-en-1-amine (PubChem CID 114476115) has the molecular formula C18H35NO and a molecular weight of 281.48 g/mol. Its IUPAC name is 1-(1-ethoxy-4,4-dimethylcyclohexyl)-N-ethyl-4-methylpent-4-en-1-amine.
| Compound Name | 1-(1-ethoxy-4,4-dimethylcyclohexyl)-N-ethyl-4-methylpent-4-en-1-amine |
|---|---|
| PubChem CID | 114476115 |
| Molecular Formula | C18H35NO |
| Molecular Weight | 281.48 g/mol |
| Exact Mass | 281.27 |
| IUPAC Name | 1-(1-ethoxy-4,4-dimethylcyclohexyl)-N-ethyl-4-methylpent-4-en-1-amine |
| SMILES | C=C(C)CCC(NCC)C1(OCC)CCC(C)(C)CC1 |
| InChI | InChI=1S/C18H35NO/c1-7-19-16(10-9-15(3)4)18(20-8-2)13-11-17(5,6)12-14-18/h16,19H,3,7-14H2,1-2,4-6H3 |
| InChIKey | HFGXAIHNKIORBH-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.48 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|