About 1-[(5,6-dimethylpyrazin-2-yl)amino]butan-2-ol
1-[(5,6-dimethylpyrazin-2-yl)amino]butan-2-ol (PubChem CID 114476222) has the molecular formula C10H17N3O
and a molecular weight of 195.27 g/mol. Its IUPAC name is 1-[(5,6-dimethylpyrazin-2-yl)amino]butan-2-ol.
Molecular Properties
| Compound Name | 1-[(5,6-dimethylpyrazin-2-yl)amino]butan-2-ol |
| PubChem CID | 114476222 |
| Molecular Formula | C10H17N3O |
| Molecular Weight | 195.27 g/mol |
| Exact Mass | 195.14 |
| IUPAC Name | 1-[(5,6-dimethylpyrazin-2-yl)amino]butan-2-ol |
| SMILES | CCC(O)CNc1cnc(C)c(C)n1 |
| InChI | InChI=1S/C10H17N3O/c1-4-9(14)5-12-10-6-11-7(2)8(3)13-10/h6,9,14H,4-5H2,1-3H3,(H,12,13) |
| InChIKey | JYUOWZALDXTYPT-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.27 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[(5,6-dimethylpyrazin-2-yl)amino]butan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(5,6-dimethylpyrazin-2-yl)amino]butan-2-ol?
The IUPAC name of 1-[(5,6-dimethylpyrazin-2-yl)amino]butan-2-ol (CID 114476222) is 1-[(5,6-dimethylpyrazin-2-yl)amino]butan-2-ol.
What is the SMILES notation for 1-[(5,6-dimethylpyrazin-2-yl)amino]butan-2-ol?
The canonical SMILES for 1-[(5,6-dimethylpyrazin-2-yl)amino]butan-2-ol is CCC(O)CNc1cnc(C)c(C)n1.
What is the InChIKey of 1-[(5,6-dimethylpyrazin-2-yl)amino]butan-2-ol?
The InChIKey is JYUOWZALDXTYPT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17N3O/c1-4-9(14)5-12-10-6-11-7(2)8(3)13-10/h6,9,14H,4-5H2,1-3H3,(H,12,13).
What are the key properties of 1-[(5,6-dimethylpyrazin-2-yl)amino]butan-2-ol?
1-[(5,6-dimethylpyrazin-2-yl)amino]butan-2-ol has a molecular weight of 195.27 g/mol, XLogP of 1.28, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(5,6-dimethylpyrazin-2-yl)amino]butan-2-ol is sourced from PubChem (CID 114476222), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).