About 4-(5,6-dimethylpyrazin-2-yl)oxy-3-prop-2-enylaniline
4-(5,6-dimethylpyrazin-2-yl)oxy-3-prop-2-enylaniline (PubChem CID 114476341) has the molecular formula C15H17N3O
and a molecular weight of 255.32 g/mol. Its IUPAC name is 4-(5,6-dimethylpyrazin-2-yl)oxy-3-prop-2-enylaniline.
Molecular Properties
| Compound Name | 4-(5,6-dimethylpyrazin-2-yl)oxy-3-prop-2-enylaniline |
| PubChem CID | 114476341 |
| Molecular Formula | C15H17N3O |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.14 |
| IUPAC Name | 4-(5,6-dimethylpyrazin-2-yl)oxy-3-prop-2-enylaniline |
| SMILES | C=CCc1cc(N)ccc1Oc1cnc(C)c(C)n1 |
| InChI | InChI=1S/C15H17N3O/c1-4-5-12-8-13(16)6-7-14(12)19-15-9-17-10(2)11(3)18-15/h4,6-9H,1,5,16H2,2-3H3 |
| InChIKey | JGDBPJFECYEHCY-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-(5,6-dimethylpyrazin-2-yl)oxy-3-prop-2-enylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(5,6-dimethylpyrazin-2-yl)oxy-3-prop-2-enylaniline?
The IUPAC name of 4-(5,6-dimethylpyrazin-2-yl)oxy-3-prop-2-enylaniline (CID 114476341) is 4-(5,6-dimethylpyrazin-2-yl)oxy-3-prop-2-enylaniline.
What is the SMILES notation for 4-(5,6-dimethylpyrazin-2-yl)oxy-3-prop-2-enylaniline?
The canonical SMILES for 4-(5,6-dimethylpyrazin-2-yl)oxy-3-prop-2-enylaniline is C=CCc1cc(N)ccc1Oc1cnc(C)c(C)n1.
What is the InChIKey of 4-(5,6-dimethylpyrazin-2-yl)oxy-3-prop-2-enylaniline?
The InChIKey is JGDBPJFECYEHCY-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17N3O/c1-4-5-12-8-13(16)6-7-14(12)19-15-9-17-10(2)11(3)18-15/h4,6-9H,1,5,16H2,2-3H3.
What are the key properties of 4-(5,6-dimethylpyrazin-2-yl)oxy-3-prop-2-enylaniline?
4-(5,6-dimethylpyrazin-2-yl)oxy-3-prop-2-enylaniline has a molecular weight of 255.32 g/mol, XLogP of 3.20, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(5,6-dimethylpyrazin-2-yl)oxy-3-prop-2-enylaniline is sourced from PubChem (CID 114476341), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).