About 3-bromo-2-(5,6-dimethylpyrazin-2-yl)oxyaniline
3-bromo-2-(5,6-dimethylpyrazin-2-yl)oxyaniline (PubChem CID 114476346) has the molecular formula C12H12BrN3O
and a molecular weight of 294.15 g/mol. Its IUPAC name is 3-bromo-2-(5,6-dimethylpyrazin-2-yl)oxyaniline.
Molecular Properties
| Compound Name | 3-bromo-2-(5,6-dimethylpyrazin-2-yl)oxyaniline |
| PubChem CID | 114476346 |
| Molecular Formula | C12H12BrN3O |
| Molecular Weight | 294.15 g/mol |
| Exact Mass | 293.02 |
| IUPAC Name | 3-bromo-2-(5,6-dimethylpyrazin-2-yl)oxyaniline |
| SMILES | Cc1ncc(Oc2c(N)cccc2Br)nc1C |
| InChI | InChI=1S/C12H12BrN3O/c1-7-8(2)16-11(6-15-7)17-12-9(13)4-3-5-10(12)14/h3-6H,14H2,1-2H3 |
| InChIKey | BFSIOXLDVQFREL-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.15 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-bromo-2-(5,6-dimethylpyrazin-2-yl)oxyaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-2-(5,6-dimethylpyrazin-2-yl)oxyaniline?
The IUPAC name of 3-bromo-2-(5,6-dimethylpyrazin-2-yl)oxyaniline (CID 114476346) is 3-bromo-2-(5,6-dimethylpyrazin-2-yl)oxyaniline.
What is the SMILES notation for 3-bromo-2-(5,6-dimethylpyrazin-2-yl)oxyaniline?
The canonical SMILES for 3-bromo-2-(5,6-dimethylpyrazin-2-yl)oxyaniline is Cc1ncc(Oc2c(N)cccc2Br)nc1C.
What is the InChIKey of 3-bromo-2-(5,6-dimethylpyrazin-2-yl)oxyaniline?
The InChIKey is BFSIOXLDVQFREL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12BrN3O/c1-7-8(2)16-11(6-15-7)17-12-9(13)4-3-5-10(12)14/h3-6H,14H2,1-2H3.
What are the key properties of 3-bromo-2-(5,6-dimethylpyrazin-2-yl)oxyaniline?
3-bromo-2-(5,6-dimethylpyrazin-2-yl)oxyaniline has a molecular weight of 294.15 g/mol, XLogP of 3.23, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-2-(5,6-dimethylpyrazin-2-yl)oxyaniline is sourced from PubChem (CID 114476346), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).