C13H12N6OS — CID 114476721
4-[5-(5,6-dimethylpyrazin-2-yl)sulfanyltetrazol-1-yl]phenol (PubChem CID 114476721) has the molecular formula C13H12N6OS and a molecular weight of 300.35 g/mol. Its IUPAC name is 4-[5-(5,6-dimethylpyrazin-2-yl)sulfanyltetrazol-1-yl]phenol.
| Compound Name | 4-[5-(5,6-dimethylpyrazin-2-yl)sulfanyltetrazol-1-yl]phenol |
|---|---|
| PubChem CID | 114476721 |
| Molecular Formula | C13H12N6OS |
| Molecular Weight | 300.35 g/mol |
| Exact Mass | 300.08 |
| IUPAC Name | 4-[5-(5,6-dimethylpyrazin-2-yl)sulfanyltetrazol-1-yl]phenol |
| SMILES | Cc1ncc(Sc2nnnn2-c2ccc(O)cc2)nc1C |
| InChI | InChI=1S/C13H12N6OS/c1-8-9(2)15-12(7-14-8)21-13-16-17-18-19(13)10-3-5-11(20)6-4-10/h3-7,20H,1-2H3 |
| InChIKey | OISDYOZHIVUADP-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 89.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.35 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |