About 4-[5-(5,6-dimethylpyrazin-2-yl)sulfanyltetrazol-1-yl]phenol
4-[5-(5,6-dimethylpyrazin-2-yl)sulfanyltetrazol-1-yl]phenol (PubChem CID 114476721) has the molecular formula C13H12N6OS
and a molecular weight of 300.35 g/mol. Its IUPAC name is 4-[5-(5,6-dimethylpyrazin-2-yl)sulfanyltetrazol-1-yl]phenol.
Molecular Properties
| Compound Name | 4-[5-(5,6-dimethylpyrazin-2-yl)sulfanyltetrazol-1-yl]phenol |
| PubChem CID | 114476721 |
| Molecular Formula | C13H12N6OS |
| Molecular Weight | 300.35 g/mol |
| Exact Mass | 300.08 |
| IUPAC Name | 4-[5-(5,6-dimethylpyrazin-2-yl)sulfanyltetrazol-1-yl]phenol |
| SMILES | Cc1ncc(Sc2nnnn2-c2ccc(O)cc2)nc1C |
| InChI | InChI=1S/C13H12N6OS/c1-8-9(2)15-12(7-14-8)21-13-16-17-18-19(13)10-3-5-11(20)6-4-10/h3-7,20H,1-2H3 |
| InChIKey | OISDYOZHIVUADP-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 89.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.35 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 4-[5-(5,6-dimethylpyrazin-2-yl)sulfanyltetrazol-1-yl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[5-(5,6-dimethylpyrazin-2-yl)sulfanyltetrazol-1-yl]phenol?
The IUPAC name of 4-[5-(5,6-dimethylpyrazin-2-yl)sulfanyltetrazol-1-yl]phenol (CID 114476721) is 4-[5-(5,6-dimethylpyrazin-2-yl)sulfanyltetrazol-1-yl]phenol.
What is the SMILES notation for 4-[5-(5,6-dimethylpyrazin-2-yl)sulfanyltetrazol-1-yl]phenol?
The canonical SMILES for 4-[5-(5,6-dimethylpyrazin-2-yl)sulfanyltetrazol-1-yl]phenol is Cc1ncc(Sc2nnnn2-c2ccc(O)cc2)nc1C.
What is the InChIKey of 4-[5-(5,6-dimethylpyrazin-2-yl)sulfanyltetrazol-1-yl]phenol?
The InChIKey is OISDYOZHIVUADP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12N6OS/c1-8-9(2)15-12(7-14-8)21-13-16-17-18-19(13)10-3-5-11(20)6-4-10/h3-7,20H,1-2H3.
What are the key properties of 4-[5-(5,6-dimethylpyrazin-2-yl)sulfanyltetrazol-1-yl]phenol?
4-[5-(5,6-dimethylpyrazin-2-yl)sulfanyltetrazol-1-yl]phenol has a molecular weight of 300.35 g/mol, XLogP of 1.93, 3 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[5-(5,6-dimethylpyrazin-2-yl)sulfanyltetrazol-1-yl]phenol is sourced from PubChem (CID 114476721), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).