C21H26N6O — CID 1144770
3-[(S)-(1-cyclopentyltetrazol-5-yl)-pyrrolidin-1-ylmethyl]-6-methyl-1H-quinolin-2-one (PubChem CID 1144770) has the molecular formula C21H26N6O and a molecular weight of 378.48 g/mol. Its IUPAC name is 3-[(S)-(1-cyclopentyltetrazol-5-yl)-pyrrolidin-1-ylmethyl]-6-methyl-1H-quinolin-2-one.
| Compound Name | 3-[(S)-(1-cyclopentyltetrazol-5-yl)-pyrrolidin-1-ylmethyl]-6-methyl-1H-quinolin-2-one |
|---|---|
| PubChem CID | 1144770 |
| Molecular Formula | C21H26N6O |
| Molecular Weight | 378.48 g/mol |
| Exact Mass | 378.22 |
| IUPAC Name | 3-[(S)-(1-cyclopentyltetrazol-5-yl)-pyrrolidin-1-ylmethyl]-6-methyl-1H-quinolin-2-one |
| SMILES | Cc1ccc2[nH]c(=O)c([C@@H](c3nnnn3C3CCCC3)N3CCCC3)cc2c1 |
| InChI | InChI=1S/C21H26N6O/c1-14-8-9-18-15(12-14)13-17(21(28)22-18)19(26-10-4-5-11-26)20-23-24-25-27(20)16-6-2-3-7-16/h8-9,12-13,16,19H,2-7,10-11H2,1H3,(H,22,28)/t19-/m0/s1 |
| InChIKey | JTOACZYUGJPSLZ-IBGZPJMESA-N |
| XLogP | 3.12 |
| TPSA | 79.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.48 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |